C23H32N6O — CID 154685077
(Z)-N'-[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-yl]-2-(prop-2-enyliminomethyl)prop-1-ene-1,3-diamine (PubChem CID 154685077) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is (Z)-N'-[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-yl]-2-(prop-2-enyliminomethyl)prop-1-ene-1,3-diamine.
| Compound Name | (Z)-N'-[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-yl]-2-(prop-2-enyliminomethyl)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 154685077 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | (Z)-N'-[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-yl]-2-(prop-2-enyliminomethyl)prop-1-ene-1,3-diamine |
| SMILES | C=CC/N=C/C(=C\N)CNC1CCN(CCc2ccnc3ccc(OC)nc23)CC1 |
| InChI | InChI=1S/C23H32N6O/c1-3-10-25-16-18(15-24)17-27-20-8-13-29(14-9-20)12-7-19-6-11-26-21-4-5-22(30-2)28-23(19)21/h3-6,11,15-16,20,27H,1,7-10,12-14,17,24H2,2H3/b18-15+,25-16+ |
| InChIKey | UKNBHFVMYXNOOR-HYKATDJESA-N |
| XLogP | 2.33 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|