C26H39N3O2 — CID 70206484
(2R)-1-[(3S)-3-ethenyl-1-heptylpiperidin-4-yl]-3-(6-methoxy-1,5-naphthyridin-4-yl)propan-2-ol (PubChem CID 70206484) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is (2R)-1-[(3S)-3-ethenyl-1-heptylpiperidin-4-yl]-3-(6-methoxy-1,5-naphthyridin-4-yl)propan-2-ol.
| Compound Name | (2R)-1-[(3S)-3-ethenyl-1-heptylpiperidin-4-yl]-3-(6-methoxy-1,5-naphthyridin-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 70206484 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | (2R)-1-[(3S)-3-ethenyl-1-heptylpiperidin-4-yl]-3-(6-methoxy-1,5-naphthyridin-4-yl)propan-2-ol |
| SMILES | C=C[C@@H]1CN(CCCCCCC)CCC1C[C@@H](O)Cc1ccnc2ccc(OC)nc12 |
| InChI | InChI=1S/C26H39N3O2/c1-4-6-7-8-9-15-29-16-13-21(20(5-2)19-29)17-23(30)18-22-12-14-27-24-10-11-25(31-3)28-26(22)24/h5,10-12,14,20-21,23,30H,2,4,6-9,13,15-19H2,1,3H3/t20-,21?,23-/m1/s1 |
| InChIKey | GMWRTRQKCKJEII-RAMXQINQSA-N |
| XLogP | 5.03 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|