C18H28N2O3Si — CID 68638441
1-[tert-butyl(dimethyl)silyl]oxy-3-(6-methoxy-1,5-naphthyridin-4-yl)propan-2-ol (PubChem CID 68638441) has the molecular formula C18H28N2O3Si and a molecular weight of 348.52 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-3-(6-methoxy-1,5-naphthyridin-4-yl)propan-2-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-(6-methoxy-1,5-naphthyridin-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 68638441 |
| Molecular Formula | C18H28N2O3Si |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-(6-methoxy-1,5-naphthyridin-4-yl)propan-2-ol |
| SMILES | COc1ccc2nccc(CC(O)CO[Si](C)(C)C(C)(C)C)c2n1 |
| InChI | InChI=1S/C18H28N2O3Si/c1-18(2,3)24(5,6)23-12-14(21)11-13-9-10-19-15-7-8-16(22-4)20-17(13)15/h7-10,14,21H,11-12H2,1-6H3 |
| InChIKey | YABUNUSLTHIOSG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|