C10H11N3O — CID 154686548
N-(3,6-dimethylimidazo[1,2-a]pyridin-2-yl)formamide (PubChem CID 154686548) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N-(3,6-dimethylimidazo[1,2-a]pyridin-2-yl)formamide.
| Compound Name | N-(3,6-dimethylimidazo[1,2-a]pyridin-2-yl)formamide |
|---|---|
| PubChem CID | 154686548 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-(3,6-dimethylimidazo[1,2-a]pyridin-2-yl)formamide |
| SMILES | Cc1ccc2nc(NC=O)c(C)n2c1 |
| InChI | InChI=1S/C10H11N3O/c1-7-3-4-9-12-10(11-6-14)8(2)13(9)5-7/h3-6H,1-2H3,(H,11,14) |
| InChIKey | GFVFHVNJOOJWPF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|