C9H15NO3 — CID 15468745
(3R,6R,7aS)-6-hydroxy-3-propan-2-yl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 15468745) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (3R,6R,7aS)-6-hydroxy-3-propan-2-yl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,6R,7aS)-6-hydroxy-3-propan-2-yl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 15468745 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (3R,6R,7aS)-6-hydroxy-3-propan-2-yl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC(C)[C@H]1OC[C@@H]2C[C@@H](O)C(=O)N21 |
| InChI | InChI=1S/C9H15NO3/c1-5(2)9-10-6(4-13-9)3-7(11)8(10)12/h5-7,9,11H,3-4H2,1-2H3/t6-,7+,9+/m0/s1 |
| InChIKey | DBHOSYDEJKQHNJ-LKEWCRSYSA-N |
| XLogP | -0.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |