C25H23FN4O — CID 154688196
N-[(3-fluorophenyl)methyl]-5-(pyridin-4-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide (PubChem CID 154688196) has the molecular formula C25H23FN4O and a molecular weight of 414.48 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-5-(pyridin-4-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-5-(pyridin-4-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 154688196 |
| Molecular Formula | C25H23FN4O |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-5-(pyridin-4-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)N1CCc2c(c3ccccc3n2Cc2ccncc2)C1 |
| InChI | InChI=1S/C25H23FN4O/c26-20-5-3-4-19(14-20)15-28-25(31)29-13-10-24-22(17-29)21-6-1-2-7-23(21)30(24)16-18-8-11-27-12-9-18/h1-9,11-12,14H,10,13,15-17H2,(H,28,31) |
| InChIKey | GDKRCTQGNPJZMD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|