C24H22FN3O2 — CID 154688256
5-[(3-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide (PubChem CID 154688256) has the molecular formula C24H22FN3O2 and a molecular weight of 403.46 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide.
| Compound Name | 5-[(3-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 154688256 |
| Molecular Formula | C24H22FN3O2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 5-[(3-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide |
| SMILES | O=C(NCc1ccco1)N1CCc2c(c3ccccc3n2Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C24H22FN3O2/c25-18-6-3-5-17(13-18)15-28-22-9-2-1-8-20(22)21-16-27(11-10-23(21)28)24(29)26-14-19-7-4-12-30-19/h1-9,12-13H,10-11,14-16H2,(H,26,29) |
| InChIKey | AUSBWJKSMOVPRJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|