C23H28N3O4S2+ — CID 154688318
[4-[1-isoquinolin-6-ylsulfinamoyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]methoxysulfanium (PubChem CID 154688318) has the molecular formula C23H28N3O4S2+ and a molecular weight of 474.63 g/mol. Its IUPAC name is [4-[1-isoquinolin-6-ylsulfinamoyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]methoxysulfanium.
| Compound Name | [4-[1-isoquinolin-6-ylsulfinamoyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]methoxysulfanium |
|---|---|
| PubChem CID | 154688318 |
| Molecular Formula | C23H28N3O4S2+ |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [4-[1-isoquinolin-6-ylsulfinamoyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]methoxysulfanium |
| SMILES | CC(C)(C)OC(=O)NCC(c1ccc(CO[SH2+])cc1)S(=O)Nc1ccc2cnccc2c1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-23(2,3)30-22(27)25-14-21(17-6-4-16(5-7-17)15-29-31)32(28)26-20-9-8-19-13-24-11-10-18(19)12-20/h4-13,21,26,31H,14-15H2,1-3H3,(H,25,27)/p+1 |
| InChIKey | YBIBYJHKOHJGAS-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|