C16H18F3N3 — CID 154691808
2-[5,5-dimethyl-3-pyrrolidin-1-yl-2-(trifluoromethyl)cyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 154691808) has the molecular formula C16H18F3N3 and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-[5,5-dimethyl-3-pyrrolidin-1-yl-2-(trifluoromethyl)cyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[5,5-dimethyl-3-pyrrolidin-1-yl-2-(trifluoromethyl)cyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 154691808 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[5,5-dimethyl-3-pyrrolidin-1-yl-2-(trifluoromethyl)cyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1(C)CC(=C(C#N)C#N)C(C(F)(F)F)=C(N2CCCC2)C1 |
| InChI | InChI=1S/C16H18F3N3/c1-15(2)7-12(11(9-20)10-21)14(16(17,18)19)13(8-15)22-5-3-4-6-22/h3-8H2,1-2H3 |
| InChIKey | FWYBJMBXGNYRCW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|