C16H20FN3 — CID 164763555
(6E)-6-(1-cyano-2-fluoroethylidene)-4,4-dimethyl-2-pyrrolidin-1-ylcyclohexene-1-carbonitrile (PubChem CID 164763555) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is (6E)-6-(1-cyano-2-fluoroethylidene)-4,4-dimethyl-2-pyrrolidin-1-ylcyclohexene-1-carbonitrile.
| Compound Name | (6E)-6-(1-cyano-2-fluoroethylidene)-4,4-dimethyl-2-pyrrolidin-1-ylcyclohexene-1-carbonitrile |
|---|---|
| PubChem CID | 164763555 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (6E)-6-(1-cyano-2-fluoroethylidene)-4,4-dimethyl-2-pyrrolidin-1-ylcyclohexene-1-carbonitrile |
| SMILES | CC1(C)CC(N2CCCC2)=C(C#N)/C(=C(\C#N)CF)C1 |
| InChI | InChI=1S/C16H20FN3/c1-16(2)7-13(12(9-17)10-18)14(11-19)15(8-16)20-5-3-4-6-20/h3-9H2,1-2H3/b13-12- |
| InChIKey | DWIXTECTSYZJGF-SEYXRHQNSA-N |
| XLogP | 3.47 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|