C15H18FN3 — CID 164763568
2-(2-fluoro-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)propanedinitrile (PubChem CID 164763568) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(2-fluoro-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)propanedinitrile.
| Compound Name | 2-(2-fluoro-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 164763568 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 2-(2-fluoro-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-ylidene)propanedinitrile |
| SMILES | CC1(C)CC(=C(C#N)C#N)C(F)=C(N2CCCC2)C1 |
| InChI | InChI=1S/C15H18FN3/c1-15(2)7-12(11(9-17)10-18)14(16)13(8-15)19-5-3-4-6-19/h3-8H2,1-2H3 |
| InChIKey | WNRZXPOXXAGRQN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|