C17H19FN4 — CID 164763127
2-[2-cyano-3-(2-fluoropiperidin-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 164763127) has the molecular formula C17H19FN4 and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-[2-cyano-3-(2-fluoropiperidin-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[2-cyano-3-(2-fluoropiperidin-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 164763127 |
| Molecular Formula | C17H19FN4 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[2-cyano-3-(2-fluoropiperidin-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1(C)CC(=C(C#N)C#N)C(C#N)=C(N2CCCCC2F)C1 |
| InChI | InChI=1S/C17H19FN4/c1-17(2)7-13(12(9-19)10-20)14(11-21)15(8-17)22-6-4-3-5-16(22)18/h16H,3-8H2,1-2H3 |
| InChIKey | XPKVPYSUJNGULH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|