C23H22F10N4 — CID 165025820
2-[2-cyano-3-[4-(1,1,2,2,3,3,4,4,5,5-decafluorohexyl)piperidin-1-yl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 165025820) has the molecular formula C23H22F10N4 and a molecular weight of 544.44 g/mol. Its IUPAC name is 2-[2-cyano-3-[4-(1,1,2,2,3,3,4,4,5,5-decafluorohexyl)piperidin-1-yl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[2-cyano-3-[4-(1,1,2,2,3,3,4,4,5,5-decafluorohexyl)piperidin-1-yl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 165025820 |
| Molecular Formula | C23H22F10N4 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 2-[2-cyano-3-[4-(1,1,2,2,3,3,4,4,5,5-decafluorohexyl)piperidin-1-yl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1(C)CC(=C(C#N)C#N)C(C#N)=C(N2CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F)CC2)C1 |
| InChI | InChI=1S/C23H22F10N4/c1-18(2)8-15(13(10-34)11-35)16(12-36)17(9-18)37-6-4-14(5-7-37)20(26,27)22(30,31)23(32,33)21(28,29)19(3,24)25/h14H,4-9H2,1-3H3 |
| InChIKey | QWPXYYFDQGOKAA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|