C26H26O3 — CID 154693631
methyl 1-[[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]methyl]cyclohexane-1-carboxylate (PubChem CID 154693631) has the molecular formula C26H26O3 and a molecular weight of 386.49 g/mol. Its IUPAC name is methyl 1-[[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 154693631 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | methyl 1-[[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(Cc2cc3cc(C#Cc4ccc(C)cc4)ccc3o2)CCCCC1 |
| InChI | InChI=1S/C26H26O3/c1-19-6-8-20(9-7-19)10-11-21-12-13-24-22(16-21)17-23(29-24)18-26(25(27)28-2)14-4-3-5-15-26/h6-9,12-13,16-17H,3-5,14-15,18H2,1-2H3 |
| InChIKey | POJRLGKPLIAKJN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|