C38H46O5 — CID 154693862
[(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 2-[[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]methyl]butanoate (PubChem CID 154693862) has the molecular formula C38H46O5 and a molecular weight of 582.78 g/mol. Its IUPAC name is [(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 2-[[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]methyl]butanoate.
| Compound Name | [(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 2-[[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]methyl]butanoate |
|---|---|
| PubChem CID | 154693862 |
| Molecular Formula | C38H46O5 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | [(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 2-[[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]methyl]butanoate |
| SMILES | CCC(Cc1cc2cc(C#Cc3ccc(C)cc3)ccc2o1)C(=O)OCC1C/C(=C\CC(CC(C)C)CC(C)C)C(=O)O1 |
| InChI | InChI=1S/C38H46O5/c1-7-31(21-34-23-33-20-29(15-17-36(33)42-34)13-12-28-10-8-27(6)9-11-28)37(39)41-24-35-22-32(38(40)43-35)16-14-30(18-25(2)3)19-26(4)5/h8-11,15-17,20,23,25-26,30-31,35H,7,14,18-19,21-22,24H2,1-6H3/b32-16+ |
| InChIKey | SWAXPBHVCNRXBJ-KPGMTVGESA-N |
| XLogP | 8.59 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|