C34H42O4 — CID 154693987
[(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-[4-[2-(4-methylphenyl)ethynyl]phenyl]propanoate (PubChem CID 154693987) has the molecular formula C34H42O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is [(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-[4-[2-(4-methylphenyl)ethynyl]phenyl]propanoate.
| Compound Name | [(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-[4-[2-(4-methylphenyl)ethynyl]phenyl]propanoate |
|---|---|
| PubChem CID | 154693987 |
| Molecular Formula | C34H42O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | [(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-[4-[2-(4-methylphenyl)ethynyl]phenyl]propanoate |
| SMILES | Cc1ccc(C#Cc2ccc(CCC(=O)OCC3C/C(=C\CC(CC(C)C)CC(C)C)C(=O)O3)cc2)cc1 |
| InChI | InChI=1S/C34H42O4/c1-24(2)20-30(21-25(3)4)16-18-31-22-32(38-34(31)36)23-37-33(35)19-17-29-14-12-28(13-15-29)11-10-27-8-6-26(5)7-9-27/h6-9,12-15,18,24-25,30,32H,16-17,19-23H2,1-5H3/b31-18+ |
| InChIKey | DBPXGSLFTAPVTJ-FDAWAROLSA-N |
| XLogP | 7.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|