C38H46O5 — CID 154693687
[(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-methyl-3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]butanoate (PubChem CID 154693687) has the molecular formula C38H46O5 and a molecular weight of 582.78 g/mol. Its IUPAC name is [(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-methyl-3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]butanoate.
| Compound Name | [(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-methyl-3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]butanoate |
|---|---|
| PubChem CID | 154693687 |
| Molecular Formula | C38H46O5 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | [(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-methyl-3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]butanoate |
| SMILES | Cc1ccc(C#Cc2ccc3oc(C(C)(C)CC(=O)OCC4C/C(=C\CC(CC(C)C)CC(C)C)C(=O)O4)cc3c2)cc1 |
| InChI | InChI=1S/C38H46O5/c1-25(2)18-30(19-26(3)4)14-16-31-21-33(42-37(31)40)24-41-36(39)23-38(6,7)35-22-32-20-29(15-17-34(32)43-35)13-12-28-10-8-27(5)9-11-28/h8-11,15-17,20,22,25-26,30,33H,14,18-19,21,23-24H2,1-7H3/b31-16+ |
| InChIKey | CBPOZZXMZNJERD-WCMJOSRZSA-N |
| XLogP | 8.69 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|