C37H46O6 — CID 154693747
methanol;[(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]propanoate (PubChem CID 154693747) has the molecular formula C37H46O6 and a molecular weight of 586.77 g/mol. Its IUPAC name is methanol;[(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]propanoate.
| Compound Name | methanol;[(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]propanoate |
|---|---|
| PubChem CID | 154693747 |
| Molecular Formula | C37H46O6 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | methanol;[(4E)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]propanoate |
| SMILES | CO.Cc1ccc(C#Cc2ccc3oc(CCC(=O)OCC4C/C(=C\CC(CC(C)C)CC(C)C)C(=O)O4)cc3c2)cc1 |
| InChI | InChI=1S/C36H42O5.CH4O/c1-24(2)18-29(19-25(3)4)12-14-30-21-33(41-36(30)38)23-39-35(37)17-15-32-22-31-20-28(13-16-34(31)40-32)11-10-27-8-6-26(5)7-9-27;1-2/h6-9,13-14,16,20,22,24-25,29,33H,12,15,17-19,21,23H2,1-5H3;2H,1H3/b30-14+; |
| InChIKey | BWDYEXYGTLNVKD-BGOJXXKFSA-N |
| XLogP | 7.57 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|