C29H28O6 — CID 154693746
[(2R)-2-(hydroxymethyl)-5-oxo-4-propan-2-ylideneoxolan-2-yl]methyl 3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]propanoate (PubChem CID 154693746) has the molecular formula C29H28O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is [(2R)-2-(hydroxymethyl)-5-oxo-4-propan-2-ylideneoxolan-2-yl]methyl 3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]propanoate.
| Compound Name | [(2R)-2-(hydroxymethyl)-5-oxo-4-propan-2-ylideneoxolan-2-yl]methyl 3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]propanoate |
|---|---|
| PubChem CID | 154693746 |
| Molecular Formula | C29H28O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | [(2R)-2-(hydroxymethyl)-5-oxo-4-propan-2-ylideneoxolan-2-yl]methyl 3-[5-[2-(4-methylphenyl)ethynyl]-1-benzofuran-2-yl]propanoate |
| SMILES | CC(C)=C1C[C@@](CO)(COC(=O)CCc2cc3cc(C#Cc4ccc(C)cc4)ccc3o2)OC1=O |
| InChI | InChI=1S/C29H28O6/c1-19(2)25-16-29(17-30,35-28(25)32)18-33-27(31)13-11-24-15-23-14-22(10-12-26(23)34-24)9-8-21-6-4-20(3)5-7-21/h4-7,10,12,14-15,30H,11,13,16-18H2,1-3H3/t29-/m1/s1 |
| InChIKey | CPZFNKRVFMMRDB-GDLZYMKVSA-N |
| XLogP | 4.63 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|