C12H14F3N — CID 154695193
2-ethyl-1-(2,4,6-trifluorophenyl)pyrrolidine (PubChem CID 154695193) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-ethyl-1-(2,4,6-trifluorophenyl)pyrrolidine.
| Compound Name | 2-ethyl-1-(2,4,6-trifluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 154695193 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-ethyl-1-(2,4,6-trifluorophenyl)pyrrolidine |
| SMILES | CCC1CCCN1c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H14F3N/c1-2-9-4-3-5-16(9)12-10(14)6-8(13)7-11(12)15/h6-7,9H,2-5H2,1H3 |
| InChIKey | JPMADOUBZRPDSA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |