C17H14F6N2O — CID 158012039
2-ethoxy-1,3-bis(2,4,6-trifluorophenyl)imidazolidine (PubChem CID 158012039) has the molecular formula C17H14F6N2O and a molecular weight of 376.30 g/mol. Its IUPAC name is 2-ethoxy-1,3-bis(2,4,6-trifluorophenyl)imidazolidine.
| Compound Name | 2-ethoxy-1,3-bis(2,4,6-trifluorophenyl)imidazolidine |
|---|---|
| PubChem CID | 158012039 |
| Molecular Formula | C17H14F6N2O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-ethoxy-1,3-bis(2,4,6-trifluorophenyl)imidazolidine |
| SMILES | CCOC1N(c2c(F)cc(F)cc2F)CCN1c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C17H14F6N2O/c1-2-26-17-24(15-11(20)5-9(18)6-12(15)21)3-4-25(17)16-13(22)7-10(19)8-14(16)23/h5-8,17H,2-4H2,1H3 |
| InChIKey | FEZVYEMBGPCRIW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |