C18H16Cl2N2 — CID 154697947
1,2-dichloro-3-N,3-N-diphenylcyclohexa-3,5-diene-1,3-diamine (PubChem CID 154697947) has the molecular formula C18H16Cl2N2 and a molecular weight of 331.25 g/mol. Its IUPAC name is 1,2-dichloro-3-N,3-N-diphenylcyclohexa-3,5-diene-1,3-diamine.
| Compound Name | 1,2-dichloro-3-N,3-N-diphenylcyclohexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 154697947 |
| Molecular Formula | C18H16Cl2N2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1,2-dichloro-3-N,3-N-diphenylcyclohexa-3,5-diene-1,3-diamine |
| SMILES | NC1(Cl)C=CC=C(N(c2ccccc2)c2ccccc2)C1Cl |
| InChI | InChI=1S/C18H16Cl2N2/c19-17-16(12-7-13-18(17,20)21)22(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-13,17H,21H2 |
| InChIKey | NJUZMRMTCPCDDQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|