C18H27ClF3N3O2Si — CID 154698232
6-chloro-N-[(2R)-1-methoxypropan-2-yl]-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 154698232) has the molecular formula C18H27ClF3N3O2Si and a molecular weight of 437.97 g/mol. Its IUPAC name is 6-chloro-N-[(2R)-1-methoxypropan-2-yl]-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 6-chloro-N-[(2R)-1-methoxypropan-2-yl]-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 154698232 |
| Molecular Formula | C18H27ClF3N3O2Si |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 6-chloro-N-[(2R)-1-methoxypropan-2-yl]-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | COC[C@@H](C)Nc1cc(Cl)nc2c1c(C(F)(F)F)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H27ClF3N3O2Si/c1-12(10-26-2)23-14-8-15(19)24-17-16(14)13(18(20,21)22)9-25(17)11-27-6-7-28(3,4)5/h8-9,12H,6-7,10-11H2,1-5H3,(H,23,24)/t12-/m1/s1 |
| InChIKey | VZTYZGJHFWTMNO-GFCCVEGCSA-N |
| XLogP | 5.47 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|