C19H17F4N3 — CID 154698875
(6R)-1-(2-pyridin-2-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole (PubChem CID 154698875) has the molecular formula C19H17F4N3 and a molecular weight of 363.36 g/mol. Its IUPAC name is (6R)-1-(2-pyridin-2-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole.
| Compound Name | (6R)-1-(2-pyridin-2-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole |
|---|---|
| PubChem CID | 154698875 |
| Molecular Formula | C19H17F4N3 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (6R)-1-(2-pyridin-2-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole |
| SMILES | Fc1cc(F)c(F)c([C@H]2CC3=C(CCc4ccccn4)NCN3C2)c1F |
| InChI | InChI=1S/C19H17F4N3/c20-13-8-14(21)19(23)17(18(13)22)11-7-16-15(25-10-26(16)9-11)5-4-12-3-1-2-6-24-12/h1-3,6,8,11,25H,4-5,7,9-10H2/t11-/m0/s1 |
| InChIKey | KMJWLXLGCCQSHZ-NSHDSACASA-N |
| XLogP | 3.83 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|