C25H29N3O3 — CID 154704669
1-(aminomethyl)-3-[3-(quinolin-2-ylamino)cyclohexyl]-3,4-dihydro-1H-isochromene-5,6-diol (PubChem CID 154704669) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-(aminomethyl)-3-[3-(quinolin-2-ylamino)cyclohexyl]-3,4-dihydro-1H-isochromene-5,6-diol.
| Compound Name | 1-(aminomethyl)-3-[3-(quinolin-2-ylamino)cyclohexyl]-3,4-dihydro-1H-isochromene-5,6-diol |
|---|---|
| PubChem CID | 154704669 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-(aminomethyl)-3-[3-(quinolin-2-ylamino)cyclohexyl]-3,4-dihydro-1H-isochromene-5,6-diol |
| SMILES | NCC1OC(C2CCCC(Nc3ccc4ccccc4n3)C2)Cc2c1ccc(O)c2O |
| InChI | InChI=1S/C25H29N3O3/c26-14-23-18-9-10-21(29)25(30)19(18)13-22(31-23)16-5-3-6-17(12-16)27-24-11-8-15-4-1-2-7-20(15)28-24/h1-2,4,7-11,16-17,22-23,29-30H,3,5-6,12-14,26H2,(H,27,28) |
| InChIKey | RXALDTSEECEODC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|