C13H20O — CID 154707186
6,6,9-trimethyldeca-1,8-dien-3-yn-5-ol (PubChem CID 154707186) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 6,6,9-trimethyldeca-1,8-dien-3-yn-5-ol.
| Compound Name | 6,6,9-trimethyldeca-1,8-dien-3-yn-5-ol |
|---|---|
| PubChem CID | 154707186 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 6,6,9-trimethyldeca-1,8-dien-3-yn-5-ol |
| SMILES | C=CC#CC(O)C(C)(C)CC=C(C)C |
| InChI | InChI=1S/C13H20O/c1-6-7-8-12(14)13(4,5)10-9-11(2)3/h6,9,12,14H,1,10H2,2-5H3 |
| InChIKey | FOXSXMMUBNJAQI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|