C14H20O — CID 14379158
(3R)-4,4-dimethyl-1-(2-methylcyclobuten-1-yl)hept-6-en-1-yn-3-ol (PubChem CID 14379158) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (3R)-4,4-dimethyl-1-(2-methylcyclobuten-1-yl)hept-6-en-1-yn-3-ol.
| Compound Name | (3R)-4,4-dimethyl-1-(2-methylcyclobuten-1-yl)hept-6-en-1-yn-3-ol |
|---|---|
| PubChem CID | 14379158 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (3R)-4,4-dimethyl-1-(2-methylcyclobuten-1-yl)hept-6-en-1-yn-3-ol |
| SMILES | C=CCC(C)(C)[C@@H](O)C#CC1=C(C)CC1 |
| InChI | InChI=1S/C14H20O/c1-5-10-14(3,4)13(15)9-8-12-7-6-11(12)2/h5,13,15H,1,6-7,10H2,2-4H3/t13-/m0/s1 |
| InChIKey | BJBNDMSFXXLYTD-ZDUSSCGKSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|