C39H45N2O2+ — CID 154707663
1,3-bis(5-tert-butyl-2-methylphenyl)-4,5-bis(4-methoxyphenyl)imidazol-1-ium (PubChem CID 154707663) has the molecular formula C39H45N2O2+ and a molecular weight of 573.80 g/mol. Its IUPAC name is 1,3-bis(5-tert-butyl-2-methylphenyl)-4,5-bis(4-methoxyphenyl)imidazol-1-ium.
| Compound Name | 1,3-bis(5-tert-butyl-2-methylphenyl)-4,5-bis(4-methoxyphenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 154707663 |
| Molecular Formula | C39H45N2O2+ |
| Molecular Weight | 573.80 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | 1,3-bis(5-tert-butyl-2-methylphenyl)-4,5-bis(4-methoxyphenyl)imidazol-1-ium |
| SMILES | COc1ccc(-c2c(-c3ccc(OC)cc3)[n+](-c3cc(C(C)(C)C)ccc3C)cn2-c2cc(C(C)(C)C)ccc2C)cc1 |
| InChI | InChI=1S/C39H45N2O2/c1-26-11-17-30(38(3,4)5)23-34(26)40-25-41(35-24-31(39(6,7)8)18-12-27(35)2)37(29-15-21-33(43-10)22-16-29)36(40)28-13-19-32(42-9)20-14-28/h11-25H,1-10H3/q+1 |
| InChIKey | WAUORIRYGNVBHN-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.80 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|