C29H25N2O2+ — CID 102390739
1,3-bis(4-methoxyphenyl)-4,5-diphenylimidazol-1-ium (PubChem CID 102390739) has the molecular formula C29H25N2O2+ and a molecular weight of 433.53 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)-4,5-diphenylimidazol-1-ium.
| Compound Name | 1,3-bis(4-methoxyphenyl)-4,5-diphenylimidazol-1-ium |
|---|---|
| PubChem CID | 102390739 |
| Molecular Formula | C29H25N2O2+ |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)-4,5-diphenylimidazol-1-ium |
| SMILES | COc1ccc(-n2c[n+](-c3ccc(OC)cc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25N2O2/c1-32-26-17-13-24(14-18-26)30-21-31(25-15-19-27(33-2)20-16-25)29(23-11-7-4-8-12-23)28(30)22-9-5-3-6-10-22/h3-21H,1-2H3/q+1 |
| InChIKey | AWZRQONHBRRHMT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|