C16H14NOS2+ — CID 11426544
3-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-3-ium-5-thiol (PubChem CID 11426544) has the molecular formula C16H14NOS2+ and a molecular weight of 300.43 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-3-ium-5-thiol.
| Compound Name | 3-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-3-ium-5-thiol |
|---|---|
| PubChem CID | 11426544 |
| Molecular Formula | C16H14NOS2+ |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-3-ium-5-thiol |
| SMILES | COc1ccc(-[n+]2csc(S)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H13NOS2/c1-18-14-9-7-13(8-10-14)17-11-20-16(19)15(17)12-5-3-2-4-6-12/h2-11H,1H3/p+1 |
| InChIKey | HSWACARJXAIFOK-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 13.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|