C15H23BO3 — CID 154711839
(2,6-dimethylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanol (PubChem CID 154711839) has the molecular formula C15H23BO3 and a molecular weight of 262.16 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanol.
| Compound Name | (2,6-dimethylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanol |
|---|---|
| PubChem CID | 154711839 |
| Molecular Formula | C15H23BO3 |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2,6-dimethylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanol |
| SMILES | Cc1cccc(C)c1C(O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H23BO3/c1-10-8-7-9-11(2)12(10)13(17)16-18-14(3,4)15(5,6)19-16/h7-9,13,17H,1-6H3 |
| InChIKey | XUFBREPTIUVVPA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|