C16H30B2O4 — CID 154712172
2-[cyclopropyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 154712172) has the molecular formula C16H30B2O4 and a molecular weight of 308.04 g/mol. Its IUPAC name is 2-[cyclopropyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[cyclopropyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154712172 |
| Molecular Formula | C16H30B2O4 |
| Molecular Weight | 308.04 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-[cyclopropyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(B2OC(C)(C)C(C)(C)O2)C2CC2)OC1(C)C |
| InChI | InChI=1S/C16H30B2O4/c1-13(2)14(3,4)20-17(19-13)12(11-9-10-11)18-21-15(5,6)16(7,8)22-18/h11-12H,9-10H2,1-8H3 |
| InChIKey | JWJDRSRPUWBSFJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.04 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|