C17H34B2O5 — CID 154713203
2-[2,2-dimethyl-1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 154713203) has the molecular formula C17H34B2O5 and a molecular weight of 340.08 g/mol. Its IUPAC name is 2-[2,2-dimethyl-1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2,2-dimethyl-1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154713203 |
| Molecular Formula | C17H34B2O5 |
| Molecular Weight | 340.08 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 2-[2,2-dimethyl-1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)C(OB1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H34B2O5/c1-13(2,3)12(18-21-14(4,5)15(6,7)22-18)20-19-23-16(8,9)17(10,11)24-19/h12H,1-11H3 |
| InChIKey | CYJYAPGBCXFOJR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.08 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|