C36H39N5O2 — CID 15471421
5,5,10,10,15,15,20,20-octamethyl-2-[2-(4-nitrophenyl)ethynyl]-21,22,23,24-tetrahydroporphyrin (PubChem CID 15471421) has the molecular formula C36H39N5O2 and a molecular weight of 573.74 g/mol. Its IUPAC name is 5,5,10,10,15,15,20,20-octamethyl-2-[2-(4-nitrophenyl)ethynyl]-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,5,10,10,15,15,20,20-octamethyl-2-[2-(4-nitrophenyl)ethynyl]-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 15471421 |
| Molecular Formula | C36H39N5O2 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 5,5,10,10,15,15,20,20-octamethyl-2-[2-(4-nitrophenyl)ethynyl]-21,22,23,24-tetrahydroporphyrin |
| SMILES | CC1(C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(C)c2[nH]c(cc2C#Cc2ccc([N+](=O)[O-])cc2)C(C)(C)c2ccc1[nH]2 |
| InChI | InChI=1S/C36H39N5O2/c1-33(2)25-15-16-26(37-25)34(3,4)28-19-20-30(39-28)36(7,8)32-23(12-9-22-10-13-24(14-11-22)41(42)43)21-31(40-32)35(5,6)29-18-17-27(33)38-29/h10-11,13-21,37-40H,1-8H3 |
| InChIKey | LMZWCUNELGMEAA-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|