C25H25BrO6 — CID 154714520
methyl (4S,4aR,7R,8aR)-4-(4-bromophenyl)-7-[2-(4-methoxyphenyl)-2-oxoethyl]-4,4a,5,6,7,8a-hexahydropyrano[2,3-b]pyran-2-carboxylate (PubChem CID 154714520) has the molecular formula C25H25BrO6 and a molecular weight of 501.37 g/mol. Its IUPAC name is methyl (4S,4aR,7R,8aR)-4-(4-bromophenyl)-7-[2-(4-methoxyphenyl)-2-oxoethyl]-4,4a,5,6,7,8a-hexahydropyrano[2,3-b]pyran-2-carboxylate.
| Compound Name | methyl (4S,4aR,7R,8aR)-4-(4-bromophenyl)-7-[2-(4-methoxyphenyl)-2-oxoethyl]-4,4a,5,6,7,8a-hexahydropyrano[2,3-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 154714520 |
| Molecular Formula | C25H25BrO6 |
| Molecular Weight | 501.37 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | methyl (4S,4aR,7R,8aR)-4-(4-bromophenyl)-7-[2-(4-methoxyphenyl)-2-oxoethyl]-4,4a,5,6,7,8a-hexahydropyrano[2,3-b]pyran-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H](c2ccc(Br)cc2)[C@H]2CC[C@H](CC(=O)c3ccc(OC)cc3)O[C@@H]2O1 |
| InChI | InChI=1S/C25H25BrO6/c1-29-18-9-5-16(6-10-18)22(27)13-19-11-12-20-21(15-3-7-17(26)8-4-15)14-23(24(28)30-2)32-25(20)31-19/h3-10,14,19-21,25H,11-13H2,1-2H3/t19-,20-,21-,25-/m1/s1 |
| InChIKey | JKAYVEIUZMBESZ-QTDDQOEGSA-N |
| XLogP | 5.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |