C17H16FNO — CID 154715473
(4S)-4-fluoro-4,9-dimethyl-2-phenyl-5H-3,1-benzoxazepine (PubChem CID 154715473) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is (4S)-4-fluoro-4,9-dimethyl-2-phenyl-5H-3,1-benzoxazepine.
| Compound Name | (4S)-4-fluoro-4,9-dimethyl-2-phenyl-5H-3,1-benzoxazepine |
|---|---|
| PubChem CID | 154715473 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (4S)-4-fluoro-4,9-dimethyl-2-phenyl-5H-3,1-benzoxazepine |
| SMILES | Cc1cccc2c1N=C(c1ccccc1)O[C@@](C)(F)C2 |
| InChI | InChI=1S/C17H16FNO/c1-12-7-6-10-14-11-17(2,18)20-16(19-15(12)14)13-8-4-3-5-9-13/h3-10H,11H2,1-2H3/t17-/m1/s1 |
| InChIKey | NXDXYTGHWSYRDR-QGZVFWFLSA-N |
| XLogP | 4.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |