C16H24O3 — CID 154715612
(2R,3R)-3-octyl-2,3-dihydro-1-benzofuran-2,5-diol (PubChem CID 154715612) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (2R,3R)-3-octyl-2,3-dihydro-1-benzofuran-2,5-diol.
| Compound Name | (2R,3R)-3-octyl-2,3-dihydro-1-benzofuran-2,5-diol |
|---|---|
| PubChem CID | 154715612 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2R,3R)-3-octyl-2,3-dihydro-1-benzofuran-2,5-diol |
| SMILES | CCCCCCCC[C@@H]1c2cc(O)ccc2O[C@H]1O |
| InChI | InChI=1S/C16H24O3/c1-2-3-4-5-6-7-8-13-14-11-12(17)9-10-15(14)19-16(13)18/h9-11,13,16-18H,2-8H2,1H3/t13-,16-/m1/s1 |
| InChIKey | OQAROYYELVWVRS-CZUORRHYSA-N |
| XLogP | 3.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|