C18H22O3 — CID 102325892
(2R,3R)-3-hexyl-2,3-dihydrobenzo[g][1]benzofuran-2,5-diol (PubChem CID 102325892) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (2R,3R)-3-hexyl-2,3-dihydrobenzo[g][1]benzofuran-2,5-diol.
| Compound Name | (2R,3R)-3-hexyl-2,3-dihydrobenzo[g][1]benzofuran-2,5-diol |
|---|---|
| PubChem CID | 102325892 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2R,3R)-3-hexyl-2,3-dihydrobenzo[g][1]benzofuran-2,5-diol |
| SMILES | CCCCCC[C@@H]1c2cc(O)c3ccccc3c2O[C@H]1O |
| InChI | InChI=1S/C18H22O3/c1-2-3-4-5-10-14-15-11-16(19)12-8-6-7-9-13(12)17(15)21-18(14)20/h6-9,11,14,18-20H,2-5,10H2,1H3/t14-,18-/m1/s1 |
| InChIKey | SJAKQESDKXNBJY-RDTXWAMCSA-N |
| XLogP | 4.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|