C15H10F2O2 — CID 154715728
3-(2,4-difluorophenyl)-5-methyl-3H-2-benzofuran-1-one (PubChem CID 154715728) has the molecular formula C15H10F2O2 and a molecular weight of 260.24 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-5-methyl-3H-2-benzofuran-1-one.
| Compound Name | 3-(2,4-difluorophenyl)-5-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 154715728 |
| Molecular Formula | C15H10F2O2 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-(2,4-difluorophenyl)-5-methyl-3H-2-benzofuran-1-one |
| SMILES | Cc1ccc2c(c1)C(c1ccc(F)cc1F)OC2=O |
| InChI | InChI=1S/C15H10F2O2/c1-8-2-4-10-12(6-8)14(19-15(10)18)11-5-3-9(16)7-13(11)17/h2-7,14H,1H3 |
| InChIKey | HJGVXPAXWYTZIA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |