C20H40O2Si — CID 154716086
trans-(3S,5R)-5-ethoxy-2,2-dimethyl-3-[tri(propan-2-yl)silylmethyl]cyclohexan-1-one (PubChem CID 154716086) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is trans-(3S,5R)-5-ethoxy-2,2-dimethyl-3-[tri(propan-2-yl)silylmethyl]cyclohexan-1-one.
| Compound Name | trans-(3S,5R)-5-ethoxy-2,2-dimethyl-3-[tri(propan-2-yl)silylmethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 154716086 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | trans-(3S,5R)-5-ethoxy-2,2-dimethyl-3-[tri(propan-2-yl)silylmethyl]cyclohexan-1-one |
| SMILES | CCO[C@H]1CC(=O)C(C)(C)[C@@H](C[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C20H40O2Si/c1-10-22-18-11-17(20(8,9)19(21)12-18)13-23(14(2)3,15(4)5)16(6)7/h14-18H,10-13H2,1-9H3/t17-,18-/m1/s1 |
| InChIKey | DYYFTPWLCBDCQH-QZTJIDSGSA-N |
| XLogP | 6.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|