C16H32O2Si — CID 154721852
trans-(3S,5R)-5-ethoxy-2,2-diethyl-3-(trimethylsilylmethyl)cyclohexan-1-one (PubChem CID 154721852) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is trans-(3S,5R)-5-ethoxy-2,2-diethyl-3-(trimethylsilylmethyl)cyclohexan-1-one.
| Compound Name | trans-(3S,5R)-5-ethoxy-2,2-diethyl-3-(trimethylsilylmethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 154721852 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | trans-(3S,5R)-5-ethoxy-2,2-diethyl-3-(trimethylsilylmethyl)cyclohexan-1-one |
| SMILES | CCO[C@H]1CC(=O)C(CC)(CC)[C@@H](C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C16H32O2Si/c1-7-16(8-2)13(12-19(4,5)6)10-14(18-9-3)11-15(16)17/h13-14H,7-12H2,1-6H3/t13-,14-/m1/s1 |
| InChIKey | IPPXCYTXYOIFHH-ZIAGYGMSSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|