C23H44O2Si — CID 154716089
(1S,3R)-3-ethoxy-1-[tri(propan-2-yl)silylmethyl]spiro[5.5]undecan-5-one (PubChem CID 154716089) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is (1S,3R)-3-ethoxy-1-[tri(propan-2-yl)silylmethyl]spiro[5.5]undecan-5-one.
| Compound Name | (1S,3R)-3-ethoxy-1-[tri(propan-2-yl)silylmethyl]spiro[5.5]undecan-5-one |
|---|---|
| PubChem CID | 154716089 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (1S,3R)-3-ethoxy-1-[tri(propan-2-yl)silylmethyl]spiro[5.5]undecan-5-one |
| SMILES | CCO[C@H]1CC(=O)C2(CCCCC2)[C@@H](C[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C23H44O2Si/c1-8-25-21-14-20(16-26(17(2)3,18(4)5)19(6)7)23(22(24)15-21)12-10-9-11-13-23/h17-21H,8-16H2,1-7H3/t20-,21-/m1/s1 |
| InChIKey | NTOCTVOFHNGWFL-NHCUHLMSSA-N |
| XLogP | 7.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|