C22H42O2Si — CID 154716088
(6S,8R)-8-ethoxy-6-[tri(propan-2-yl)silylmethyl]spiro[4.5]decan-10-one (PubChem CID 154716088) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is (6S,8R)-8-ethoxy-6-[tri(propan-2-yl)silylmethyl]spiro[4.5]decan-10-one.
| Compound Name | (6S,8R)-8-ethoxy-6-[tri(propan-2-yl)silylmethyl]spiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 154716088 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (6S,8R)-8-ethoxy-6-[tri(propan-2-yl)silylmethyl]spiro[4.5]decan-10-one |
| SMILES | CCO[C@H]1CC(=O)C2(CCCC2)[C@@H](C[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C22H42O2Si/c1-8-24-20-13-19(22(21(23)14-20)11-9-10-12-22)15-25(16(2)3,17(4)5)18(6)7/h16-20H,8-15H2,1-7H3/t19-,20-/m1/s1 |
| InChIKey | DOEWLDMWQKBNNB-WOJBJXKFSA-N |
| XLogP | 6.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|