C21H21NO2 — CID 154716244
(2R,3R)-1'-benzyl-2-ethenyl-3-hydroxyspiro[cyclopentane-1,3'-indole]-2'-one (PubChem CID 154716244) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (2R,3R)-1'-benzyl-2-ethenyl-3-hydroxyspiro[cyclopentane-1,3'-indole]-2'-one.
| Compound Name | (2R,3R)-1'-benzyl-2-ethenyl-3-hydroxyspiro[cyclopentane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 154716244 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (2R,3R)-1'-benzyl-2-ethenyl-3-hydroxyspiro[cyclopentane-1,3'-indole]-2'-one |
| SMILES | C=C[C@H]1[C@H](O)CCC12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C21H21NO2/c1-2-16-19(23)12-13-21(16)17-10-6-7-11-18(17)22(20(21)24)14-15-8-4-3-5-9-15/h2-11,16,19,23H,1,12-14H2/t16-,19+,21?/m0/s1 |
| InChIKey | BPGCCLLLCJYSHI-FZWXSHBKSA-N |
| XLogP | 3.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|