C18H16F3NO2 — CID 156693694
3-methyl-1-phenyl-3-(3,3,3-trifluoro-2-hydroxypropyl)indol-2-one (PubChem CID 156693694) has the molecular formula C18H16F3NO2 and a molecular weight of 335.32 g/mol. Its IUPAC name is 3-methyl-1-phenyl-3-(3,3,3-trifluoro-2-hydroxypropyl)indol-2-one.
| Compound Name | 3-methyl-1-phenyl-3-(3,3,3-trifluoro-2-hydroxypropyl)indol-2-one |
|---|---|
| PubChem CID | 156693694 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-methyl-1-phenyl-3-(3,3,3-trifluoro-2-hydroxypropyl)indol-2-one |
| SMILES | CC1(CC(O)C(F)(F)F)C(=O)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H16F3NO2/c1-17(11-15(23)18(19,20)21)13-9-5-6-10-14(13)22(16(17)24)12-7-3-2-4-8-12/h2-10,15,23H,11H2,1H3 |
| InChIKey | ZVVLMCASQQMAPN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |