C23H28BFO2 — CID 154718674
2-[(E)-2-(3-fluorophenyl)-4-phenylpent-3-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 154718674) has the molecular formula C23H28BFO2 and a molecular weight of 366.29 g/mol. Its IUPAC name is 2-[(E)-2-(3-fluorophenyl)-4-phenylpent-3-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-2-(3-fluorophenyl)-4-phenylpent-3-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154718674 |
| Molecular Formula | C23H28BFO2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-[(E)-2-(3-fluorophenyl)-4-phenylpent-3-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C/C(=C\C(CB1OC(C)(C)C(C)(C)O1)c1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C23H28BFO2/c1-17(18-10-7-6-8-11-18)14-20(19-12-9-13-21(25)15-19)16-24-26-22(2,3)23(4,5)27-24/h6-15,20H,16H2,1-5H3/b17-14+ |
| InChIKey | ANVREOFSHGSPCA-SAPNQHFASA-N |
| XLogP | 6.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|