C27H39BO2Si — CID 11259077
dimethyl-[(E)-2-methyl-1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-2-enyl]-phenylsilane (PubChem CID 11259077) has the molecular formula C27H39BO2Si and a molecular weight of 434.51 g/mol. Its IUPAC name is dimethyl-[(E)-2-methyl-1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-2-enyl]-phenylsilane.
| Compound Name | dimethyl-[(E)-2-methyl-1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-2-enyl]-phenylsilane |
|---|---|
| PubChem CID | 11259077 |
| Molecular Formula | C27H39BO2Si |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | dimethyl-[(E)-2-methyl-1-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-2-enyl]-phenylsilane |
| SMILES | C/C(=C\CCCB1OC(C)(C)C(C)(C)O1)C(c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C27H39BO2Si/c1-22(16-14-15-21-28-29-26(2,3)27(4,5)30-28)25(23-17-10-8-11-18-23)31(6,7)24-19-12-9-13-20-24/h8-13,16-20,25H,14-15,21H2,1-7H3/b22-16+ |
| InChIKey | TVGSGFZDNAANJD-CJLVFECKSA-N |
| XLogP | 6.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|