C24H31BO2 — CID 154712426
4,4,5,5-tetramethyl-2-[(E)-4-(4-methylphenyl)-2-phenylpent-3-enyl]-1,3,2-dioxaborolane (PubChem CID 154712426) has the molecular formula C24H31BO2 and a molecular weight of 362.32 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-4-(4-methylphenyl)-2-phenylpent-3-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-4-(4-methylphenyl)-2-phenylpent-3-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154712426 |
| Molecular Formula | C24H31BO2 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-4-(4-methylphenyl)-2-phenylpent-3-enyl]-1,3,2-dioxaborolane |
| SMILES | C/C(=C\C(CB1OC(C)(C)C(C)(C)O1)c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H31BO2/c1-18-12-14-20(15-13-18)19(2)16-22(21-10-8-7-9-11-21)17-25-26-23(3,4)24(5,6)27-25/h7-16,22H,17H2,1-6H3/b19-16+ |
| InChIKey | YDAUHPFXYICAPU-KNTRCKAVSA-N |
| XLogP | 6.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|