C18H31BO2Si — CID 177455263
trimethyl-[1-(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]silane (PubChem CID 177455263) has the molecular formula C18H31BO2Si and a molecular weight of 318.34 g/mol. Its IUPAC name is trimethyl-[1-(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]silane.
| Compound Name | trimethyl-[1-(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]silane |
|---|---|
| PubChem CID | 177455263 |
| Molecular Formula | C18H31BO2Si |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | trimethyl-[1-(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]silane |
| SMILES | Cc1ccc(C(CB2OC(C)(C)C(C)(C)O2)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H31BO2Si/c1-14-9-11-15(12-10-14)16(22(6,7)8)13-19-20-17(2,3)18(4,5)21-19/h9-12,16H,13H2,1-8H3 |
| InChIKey | UHNRUVVASPVKRW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|