C36H31NO5 — CID 154719231
(1,3-dioxoisoindol-2-yl) 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate (PubChem CID 154719231) has the molecular formula C36H31NO5 and a molecular weight of 557.65 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 154719231 |
| Molecular Formula | C36H31NO5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate |
| SMILES | COc1ccc(-c2ccc3cc(C(=O)ON4C(=O)c5ccccc5C4=O)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C36H31NO5/c1-41-32-11-10-27(17-31(32)36-18-21-12-22(19-36)14-23(13-21)20-36)25-6-7-26-16-28(9-8-24(26)15-25)35(40)42-37-33(38)29-4-2-3-5-30(29)34(37)39/h2-11,15-17,21-23H,12-14,18-20H2,1H3 |
| InChIKey | FTBWDFUSSODDSG-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|